C26H56O3SiSn — CID 12786207
[(E)-4-(dimethoxymethyl)-1-tributylstannyloct-1-en-4-yl]oxy-trimethylsilane (PubChem CID 12786207) has the molecular formula C26H56O3SiSn and a molecular weight of 563.53 g/mol. Its IUPAC name is [(E)-4-(dimethoxymethyl)-1-tributylstannyloct-1-en-4-yl]oxy-trimethylsilane.
| Compound Name | [(E)-4-(dimethoxymethyl)-1-tributylstannyloct-1-en-4-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 12786207 |
| Molecular Formula | C26H56O3SiSn |
| Molecular Weight | 563.53 g/mol |
| Exact Mass | 564.30 |
| IUPAC Name | [(E)-4-(dimethoxymethyl)-1-tributylstannyloct-1-en-4-yl]oxy-trimethylsilane |
| SMILES | CCCCC(C/C=C/[Sn](CCCC)(CCCC)CCCC)(O[Si](C)(C)C)C(OC)OC |
| InChI | InChI=1S/C14H29O3Si.3C4H9.Sn/c1-8-10-12-14(11-9-2,13(15-3)16-4)17-18(5,6)7;3*1-3-4-2;/h2,9,13H,8,10-12H2,1,3-7H3;3*1,3-4H2,2H3; |
| InChIKey | QWVSNVFEJDWSPC-UHFFFAOYSA-N |
| XLogP | 8.72 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.53 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|