C26H58O4SSiSn2 — CID 173440768
ethenylstannane;5-methyl-8-tributylstannyl-5-trimethylsilyloxyoct-7-ene-2-sulfonic acid (PubChem CID 173440768) has the molecular formula C26H58O4SSiSn2 and a molecular weight of 732.32 g/mol. Its IUPAC name is ethenylstannane;5-methyl-8-tributylstannyl-5-trimethylsilyloxyoct-7-ene-2-sulfonic acid.
| Compound Name | ethenylstannane;5-methyl-8-tributylstannyl-5-trimethylsilyloxyoct-7-ene-2-sulfonic acid |
|---|---|
| PubChem CID | 173440768 |
| Molecular Formula | C26H58O4SSiSn2 |
| Molecular Weight | 732.32 g/mol |
| Exact Mass | 734.19 |
| IUPAC Name | ethenylstannane;5-methyl-8-tributylstannyl-5-trimethylsilyloxyoct-7-ene-2-sulfonic acid |
| SMILES | C=C[SnH3].CCCC[Sn](C=CCC(C)(CCC(C)S(=O)(=O)O)O[Si](C)(C)C)(CCCC)CCCC |
| InChI | InChI=1S/C12H25O4SSi.3C4H9.C2H3.2Sn.3H/c1-7-9-12(3,16-18(4,5)6)10-8-11(2)17(13,14)15;3*1-3-4-2;1-2;;;;;/h1,7,11H,8-10H2,2-6H3,(H,13,14,15);3*1,3-4H2,2H3;1H,2H2;;;;; |
| InChIKey | NXZRXGXEHZJZIG-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.32 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|