C7H8F2O — CID 88877969
(2E,4Z)-1,6-difluorohepta-2,4,6-trien-3-ol (PubChem CID 88877969) has the molecular formula C7H8F2O and a molecular weight of 146.14 g/mol. Its IUPAC name is (2E,4Z)-1,6-difluorohepta-2,4,6-trien-3-ol.
| Compound Name | (2E,4Z)-1,6-difluorohepta-2,4,6-trien-3-ol |
|---|---|
| PubChem CID | 88877969 |
| Molecular Formula | C7H8F2O |
| Molecular Weight | 146.14 g/mol |
| Exact Mass | 146.05 |
| IUPAC Name | (2E,4Z)-1,6-difluorohepta-2,4,6-trien-3-ol |
| SMILES | C=C(F)/C=C\C(O)=C/CF |
| InChI | InChI=1S/C7H8F2O/c1-6(9)2-3-7(10)4-5-8/h2-4,10H,1,5H2/b3-2-,7-4+ |
| InChIKey | SHPABKXMAOZLQU-UDJLOATDSA-N |
| XLogP | 2.44 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.14 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|