C5H7F3 — CID 91442449
ethene;1,1,3-trifluoroprop-1-ene (PubChem CID 91442449) has the molecular formula C5H7F3 and a molecular weight of 124.10 g/mol. Its IUPAC name is ethene;1,1,3-trifluoroprop-1-ene.
| Compound Name | ethene;1,1,3-trifluoroprop-1-ene |
|---|---|
| PubChem CID | 91442449 |
| Molecular Formula | C5H7F3 |
| Molecular Weight | 124.10 g/mol |
| Exact Mass | 124.05 |
| IUPAC Name | ethene;1,1,3-trifluoroprop-1-ene |
| SMILES | C=C.FCC=C(F)F |
| InChI | InChI=1S/C3H3F3.C2H4/c4-2-1-3(5)6;1-2/h1H,2H2;1-2H2 |
| InChIKey | RMRODNHXMFZWLN-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.10 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|