C8H12F2O — CID 88890754
(5Z)-3,7-difluoroocta-5,7-dien-1-ol (PubChem CID 88890754) has the molecular formula C8H12F2O and a molecular weight of 162.18 g/mol. Its IUPAC name is (5Z)-3,7-difluoroocta-5,7-dien-1-ol.
| Compound Name | (5Z)-3,7-difluoroocta-5,7-dien-1-ol |
|---|---|
| PubChem CID | 88890754 |
| Molecular Formula | C8H12F2O |
| Molecular Weight | 162.18 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | (5Z)-3,7-difluoroocta-5,7-dien-1-ol |
| SMILES | C=C(F)/C=C\CC(F)CCO |
| InChI | InChI=1S/C8H12F2O/c1-7(9)3-2-4-8(10)5-6-11/h2-3,8,11H,1,4-6H2/b3-2- |
| InChIKey | LIOGRRWUDJTKRJ-IHWYPQMZSA-N |
| XLogP | 2.14 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.18 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|