C11H20O — CID 54173872
6-methyl-3-propan-2-ylhepta-4,6-dien-1-ol (PubChem CID 54173872) has the molecular formula C11H20O and a molecular weight of 168.28 g/mol. Its IUPAC name is 6-methyl-3-propan-2-ylhepta-4,6-dien-1-ol.
| Compound Name | 6-methyl-3-propan-2-ylhepta-4,6-dien-1-ol |
|---|---|
| PubChem CID | 54173872 |
| Molecular Formula | C11H20O |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.15 |
| IUPAC Name | 6-methyl-3-propan-2-ylhepta-4,6-dien-1-ol |
| SMILES | C=C(C)C=CC(CCO)C(C)C |
| InChI | InChI=1S/C11H20O/c1-9(2)5-6-11(7-8-12)10(3)4/h5-6,10-12H,1,7-8H2,2-4H3 |
| InChIKey | OWXDIPXDTAMOOI-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|