C13H22O2 — CID 45141058
[(3R,4E)-6-methyl-3-propan-2-ylhepta-4,6-dienyl] acetate (PubChem CID 45141058) has the molecular formula C13H22O2 and a molecular weight of 210.32 g/mol. Its IUPAC name is [(3R,4E)-6-methyl-3-propan-2-ylhepta-4,6-dienyl] acetate.
| Compound Name | [(3R,4E)-6-methyl-3-propan-2-ylhepta-4,6-dienyl] acetate |
|---|---|
| PubChem CID | 45141058 |
| Molecular Formula | C13H22O2 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | [(3R,4E)-6-methyl-3-propan-2-ylhepta-4,6-dienyl] acetate |
| SMILES | C=C(C)/C=C/C(CCOC(C)=O)C(C)C |
| InChI | InChI=1S/C13H22O2/c1-10(2)6-7-13(11(3)4)8-9-15-12(5)14/h6-7,11,13H,1,8-9H2,2-5H3/b7-6+ |
| InChIKey | YCDKUGCYKSJDOM-VOTSOKGWSA-N |
| XLogP | 3.34 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|