C12H22O2 — CID 14805466
(7E)-4,9-dimethyldeca-7,9-diene-1,6-diol (PubChem CID 14805466) has the molecular formula C12H22O2 and a molecular weight of 198.31 g/mol. Its IUPAC name is (7E)-4,9-dimethyldeca-7,9-diene-1,6-diol.
| Compound Name | (7E)-4,9-dimethyldeca-7,9-diene-1,6-diol |
|---|---|
| PubChem CID | 14805466 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | (7E)-4,9-dimethyldeca-7,9-diene-1,6-diol |
| SMILES | C=C(C)/C=C/C(O)CC(C)CCCO |
| InChI | InChI=1S/C12H22O2/c1-10(2)6-7-12(14)9-11(3)5-4-8-13/h6-7,11-14H,1,4-5,8-9H2,2-3H3/b7-6+ |
| InChIKey | AQCUUOFORRMCPV-VOTSOKGWSA-N |
| XLogP | 2.28 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|