About CID 59707573
CID 59707573 (PubChem CID 59707573) has the molecular formula C8H17O
and a molecular weight of 129.22 g/mol.
Molecular Properties
| Compound Name | CID 59707573 |
| PubChem CID | 59707573 |
| Molecular Formula | C8H17O |
| Molecular Weight | 129.22 g/mol |
| Exact Mass | 129.13 |
| IUPAC Name | — |
| SMILES | [CH2]CCC(C)CCCO |
| InChI | InChI=1S/C8H17O/c1-3-5-8(2)6-4-7-9/h8-9H,1,3-7H2,2H3 |
| InChIKey | ZAQABJSLZAMSBK-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.22 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 59707573 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59707573?
The IUPAC name of CID 59707573 (CID 59707573) is not available.
What is the SMILES notation for CID 59707573?
The canonical SMILES for CID 59707573 is [CH2]CCC(C)CCCO.
What is the InChIKey of CID 59707573?
The InChIKey is ZAQABJSLZAMSBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17O/c1-3-5-8(2)6-4-7-9/h8-9H,1,3-7H2,2H3.
What are the key properties of CID 59707573?
CID 59707573 has a molecular weight of 129.22 g/mol, XLogP of 2.01, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59707573 is sourced from PubChem (CID 59707573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).