C12H20O — CID 14893880
(3E)-2,7,7-trimethylnona-1,3,8-trien-5-ol (PubChem CID 14893880) has the molecular formula C12H20O and a molecular weight of 180.29 g/mol. Its IUPAC name is (3E)-2,7,7-trimethylnona-1,3,8-trien-5-ol.
| Compound Name | (3E)-2,7,7-trimethylnona-1,3,8-trien-5-ol |
|---|---|
| PubChem CID | 14893880 |
| Molecular Formula | C12H20O |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.15 |
| IUPAC Name | (3E)-2,7,7-trimethylnona-1,3,8-trien-5-ol |
| SMILES | C=CC(C)(C)CC(O)/C=C/C(=C)C |
| InChI | InChI=1S/C12H20O/c1-6-12(4,5)9-11(13)8-7-10(2)3/h6-8,11,13H,1-2,9H2,3-5H3/b8-7+ |
| InChIKey | MWWZEUJHDJMIOG-BQYQJAHWSA-N |
| XLogP | 3.08 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|