C22H38O — CID 161329766
(4R)-6,6-dimethyloct-7-en-1-yn-4-ol;methane;(5R)-3,3,5-trimethyloct-1-en-7-yne (PubChem CID 161329766) has the molecular formula C22H38O and a molecular weight of 318.55 g/mol. Its IUPAC name is (4R)-6,6-dimethyloct-7-en-1-yn-4-ol;methane;(5R)-3,3,5-trimethyloct-1-en-7-yne.
| Compound Name | (4R)-6,6-dimethyloct-7-en-1-yn-4-ol;methane;(5R)-3,3,5-trimethyloct-1-en-7-yne |
|---|---|
| PubChem CID | 161329766 |
| Molecular Formula | C22H38O |
| Molecular Weight | 318.55 g/mol |
| Exact Mass | 318.29 |
| IUPAC Name | (4R)-6,6-dimethyloct-7-en-1-yn-4-ol;methane;(5R)-3,3,5-trimethyloct-1-en-7-yne |
| SMILES | C.C#CC[C@@H](C)CC(C)(C)C=C.C#CC[C@@H](O)CC(C)(C)C=C |
| InChI | InChI=1S/C11H18.C10H16O.CH4/c1-6-8-10(3)9-11(4,5)7-2;1-5-7-9(11)8-10(3,4)6-2;/h1,7,10H,2,8-9H2,3-5H3;1,6,9,11H,2,7-8H2,3-4H3;1H4/t10-;9-;/m11./s1 |
| InChIKey | VLGMPCWEFRBQPV-HNWRFUOOSA-N |
| XLogP | 5.86 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.55 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|