C10H19IO — CID 54035971
(3S,5S)-1-iodo-5-methylnon-1-en-3-ol (PubChem CID 54035971) has the molecular formula C10H19IO and a molecular weight of 282.16 g/mol. Its IUPAC name is (3S,5S)-1-iodo-5-methylnon-1-en-3-ol.
| Compound Name | (3S,5S)-1-iodo-5-methylnon-1-en-3-ol |
|---|---|
| PubChem CID | 54035971 |
| Molecular Formula | C10H19IO |
| Molecular Weight | 282.16 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | (3S,5S)-1-iodo-5-methylnon-1-en-3-ol |
| SMILES | CCCC[C@H](C)C[C@H](O)C=CI |
| InChI | InChI=1S/C10H19IO/c1-3-4-5-9(2)8-10(12)6-7-11/h6-7,9-10,12H,3-5,8H2,1-2H3/t9-,10+/m0/s1 |
| InChIKey | LIYPSGLLRNCNBR-VHSXEESVSA-N |
| XLogP | 3.51 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.16 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|