C18H32O2 — CID 141034315
1-[(E,3R,5S)-3-hydroxy-5-methylnon-1-enyl]-1,2,3,3a,4,5,6,6a-octahydropentalen-2-ol (PubChem CID 141034315) has the molecular formula C18H32O2 and a molecular weight of 280.45 g/mol. Its IUPAC name is 1-[(E,3R,5S)-3-hydroxy-5-methylnon-1-enyl]-1,2,3,3a,4,5,6,6a-octahydropentalen-2-ol.
| Compound Name | 1-[(E,3R,5S)-3-hydroxy-5-methylnon-1-enyl]-1,2,3,3a,4,5,6,6a-octahydropentalen-2-ol |
|---|---|
| PubChem CID | 141034315 |
| Molecular Formula | C18H32O2 |
| Molecular Weight | 280.45 g/mol |
| Exact Mass | 280.24 |
| IUPAC Name | 1-[(E,3R,5S)-3-hydroxy-5-methylnon-1-enyl]-1,2,3,3a,4,5,6,6a-octahydropentalen-2-ol |
| SMILES | CCCC[C@H](C)C[C@@H](O)/C=C/C1C(O)CC2CCCC21 |
| InChI | InChI=1S/C18H32O2/c1-3-4-6-13(2)11-15(19)9-10-17-16-8-5-7-14(16)12-18(17)20/h9-10,13-20H,3-8,11-12H2,1-2H3/b10-9+/t13-,14?,15-,16?,17?,18?/m0/s1 |
| InChIKey | ZDKDNRXRKXCNHB-OCYXAJTPSA-N |
| XLogP | 3.92 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.45 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|