C26H45NO2 — CID 90710862
(2R,3R,3aS,6aS)-5-[6-(dimethylamino)hex-1-enyl]-3-[(3S,5S)-3-hydroxy-5-methylnon-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol (PubChem CID 90710862) has the molecular formula C26H45NO2 and a molecular weight of 403.65 g/mol. Its IUPAC name is (2R,3R,3aS,6aS)-5-[6-(dimethylamino)hex-1-enyl]-3-[(3S,5S)-3-hydroxy-5-methylnon-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol.
| Compound Name | (2R,3R,3aS,6aS)-5-[6-(dimethylamino)hex-1-enyl]-3-[(3S,5S)-3-hydroxy-5-methylnon-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol |
|---|---|
| PubChem CID | 90710862 |
| Molecular Formula | C26H45NO2 |
| Molecular Weight | 403.65 g/mol |
| Exact Mass | 403.35 |
| IUPAC Name | (2R,3R,3aS,6aS)-5-[6-(dimethylamino)hex-1-enyl]-3-[(3S,5S)-3-hydroxy-5-methylnon-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol |
| SMILES | CCCC[C@H](C)C[C@H](O)C=C[C@@H]1[C@H]2CC(C=CCCCCN(C)C)=C[C@H]2C[C@H]1O |
| InChI | InChI=1S/C26H45NO2/c1-5-6-11-20(2)16-23(28)13-14-24-25-18-21(17-22(25)19-26(24)29)12-9-7-8-10-15-27(3)4/h9,12-14,17,20,22-26,28-29H,5-8,10-11,15-16,18-19H2,1-4H3/t20-,22-,23+,24+,25-,26+/m0/s1 |
| InChIKey | SLHNQXWINLKEIR-MFJVRWMJSA-N |
| XLogP | 5.35 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.65 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|