C22H34O4 — CID 54144298
5-[(3aS,5R,6S,6aS)-5-hydroxy-6-[(3S)-3-hydroxy-5-methyloct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pent-4-enoic acid (PubChem CID 54144298) has the molecular formula C22H34O4 and a molecular weight of 362.51 g/mol. Its IUPAC name is 5-[(3aS,5R,6S,6aS)-5-hydroxy-6-[(3S)-3-hydroxy-5-methyloct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pent-4-enoic acid.
| Compound Name | 5-[(3aS,5R,6S,6aS)-5-hydroxy-6-[(3S)-3-hydroxy-5-methyloct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pent-4-enoic acid |
|---|---|
| PubChem CID | 54144298 |
| Molecular Formula | C22H34O4 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | 5-[(3aS,5R,6S,6aS)-5-hydroxy-6-[(3S)-3-hydroxy-5-methyloct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pent-4-enoic acid |
| SMILES | CCCC(C)C[C@H](O)C=C[C@H]1[C@H]2CC(C=CCCC(=O)O)=C[C@H]2C[C@H]1O |
| InChI | InChI=1S/C22H34O4/c1-3-6-15(2)11-18(23)9-10-19-20-13-16(7-4-5-8-22(25)26)12-17(20)14-21(19)24/h4,7,9-10,12,15,17-21,23-24H,3,5-6,8,11,13-14H2,1-2H3,(H,25,26)/t15?,17-,18+,19-,20-,21+/m0/s1 |
| InChIKey | ODGWJQJHHNJOHA-ZRVHWYDGSA-N |
| XLogP | 4.09 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|