C27H38O4 — CID 22862287
2-[3-[(3aS,5R,6S,6aS)-5-hydroxy-6-[(E,3S)-3-hydroxy-5-methyloct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]propyl]benzoic acid (PubChem CID 22862287) has the molecular formula C27H38O4 and a molecular weight of 426.60 g/mol. Its IUPAC name is 2-[3-[(3aS,5R,6S,6aS)-5-hydroxy-6-[(E,3S)-3-hydroxy-5-methyloct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]propyl]benzoic acid.
| Compound Name | 2-[3-[(3aS,5R,6S,6aS)-5-hydroxy-6-[(E,3S)-3-hydroxy-5-methyloct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]propyl]benzoic acid |
|---|---|
| PubChem CID | 22862287 |
| Molecular Formula | C27H38O4 |
| Molecular Weight | 426.60 g/mol |
| Exact Mass | 426.28 |
| IUPAC Name | 2-[3-[(3aS,5R,6S,6aS)-5-hydroxy-6-[(E,3S)-3-hydroxy-5-methyloct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]propyl]benzoic acid |
| SMILES | CCCC(C)C[C@H](O)/C=C/[C@H]1[C@H]2CC(CCCc3ccccc3C(=O)O)=C[C@H]2C[C@H]1O |
| InChI | InChI=1S/C27H38O4/c1-3-7-18(2)14-22(28)12-13-24-25-16-19(15-21(25)17-26(24)29)8-6-10-20-9-4-5-11-23(20)27(30)31/h4-5,9,11-13,15,18,21-22,24-26,28-29H,3,6-8,10,14,16-17H2,1-2H3,(H,30,31)/b13-12+/t18?,21-,22+,24-,25-,26+/m0/s1 |
| InChIKey | HSAVSTNCFSLVBY-GKIKLBCDSA-N |
| XLogP | 5.39 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.60 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|