C25H34O4 — CID 57237629
2-[2-[(3aS,5R,6S,6aS)-5-hydroxy-6-[(3S)-3-hydroxyoct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]ethyl]benzoic acid (PubChem CID 57237629) has the molecular formula C25H34O4 and a molecular weight of 398.54 g/mol. Its IUPAC name is 2-[2-[(3aS,5R,6S,6aS)-5-hydroxy-6-[(3S)-3-hydroxyoct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]ethyl]benzoic acid.
| Compound Name | 2-[2-[(3aS,5R,6S,6aS)-5-hydroxy-6-[(3S)-3-hydroxyoct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]ethyl]benzoic acid |
|---|---|
| PubChem CID | 57237629 |
| Molecular Formula | C25H34O4 |
| Molecular Weight | 398.54 g/mol |
| Exact Mass | 398.25 |
| IUPAC Name | 2-[2-[(3aS,5R,6S,6aS)-5-hydroxy-6-[(3S)-3-hydroxyoct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]ethyl]benzoic acid |
| SMILES | CCCCC[C@H](O)C=C[C@H]1[C@H]2CC(CCc3ccccc3C(=O)O)=C[C@H]2C[C@H]1O |
| InChI | InChI=1S/C25H34O4/c1-2-3-4-8-20(26)12-13-22-23-15-17(14-19(23)16-24(22)27)10-11-18-7-5-6-9-21(18)25(28)29/h5-7,9,12-14,19-20,22-24,26-27H,2-4,8,10-11,15-16H2,1H3,(H,28,29)/t19-,20-,22-,23-,24+/m0/s1 |
| InChIKey | LJGMCHWVEXITFD-HRKPPWRHSA-N |
| XLogP | 4.76 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.54 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|