C25H32O4 — CID 57226147
2-[2-[(3aS,5R,6S,6aS)-6-[(3S)-3-cyclopentyl-3-hydroxyprop-1-enyl]-5-hydroxy-1,3a,4,5,6,6a-hexahydropentalen-2-yl]ethyl]benzoic acid (PubChem CID 57226147) has the molecular formula C25H32O4 and a molecular weight of 396.53 g/mol. Its IUPAC name is 2-[2-[(3aS,5R,6S,6aS)-6-[(3S)-3-cyclopentyl-3-hydroxyprop-1-enyl]-5-hydroxy-1,3a,4,5,6,6a-hexahydropentalen-2-yl]ethyl]benzoic acid.
| Compound Name | 2-[2-[(3aS,5R,6S,6aS)-6-[(3S)-3-cyclopentyl-3-hydroxyprop-1-enyl]-5-hydroxy-1,3a,4,5,6,6a-hexahydropentalen-2-yl]ethyl]benzoic acid |
|---|---|
| PubChem CID | 57226147 |
| Molecular Formula | C25H32O4 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | 2-[2-[(3aS,5R,6S,6aS)-6-[(3S)-3-cyclopentyl-3-hydroxyprop-1-enyl]-5-hydroxy-1,3a,4,5,6,6a-hexahydropentalen-2-yl]ethyl]benzoic acid |
| SMILES | O=C(O)c1ccccc1CCC1=C[C@H]2C[C@@H](O)[C@@H](C=C[C@@H](O)C3CCCC3)[C@H]2C1 |
| InChI | InChI=1S/C25H32O4/c26-23(18-6-1-2-7-18)12-11-21-22-14-16(13-19(22)15-24(21)27)9-10-17-5-3-4-8-20(17)25(28)29/h3-5,8,11-13,18-19,21-24,26-27H,1-2,6-7,9-10,14-15H2,(H,28,29)/t19-,21-,22-,23+,24+/m0/s1 |
| InChIKey | USGMUYLRHGACFW-FXOREOJDSA-N |
| XLogP | 4.37 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|