C24H30O4 — CID 57112974
2-[[(3aS,5R,6S,6aS)-6-[(3S)-3-cyclopentyl-3-hydroxyprop-1-enyl]-5-hydroxy-1,3a,4,5,6,6a-hexahydropentalen-2-yl]methyl]benzoic acid (PubChem CID 57112974) has the molecular formula C24H30O4 and a molecular weight of 382.50 g/mol. Its IUPAC name is 2-[[(3aS,5R,6S,6aS)-6-[(3S)-3-cyclopentyl-3-hydroxyprop-1-enyl]-5-hydroxy-1,3a,4,5,6,6a-hexahydropentalen-2-yl]methyl]benzoic acid.
| Compound Name | 2-[[(3aS,5R,6S,6aS)-6-[(3S)-3-cyclopentyl-3-hydroxyprop-1-enyl]-5-hydroxy-1,3a,4,5,6,6a-hexahydropentalen-2-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 57112974 |
| Molecular Formula | C24H30O4 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | 2-[[(3aS,5R,6S,6aS)-6-[(3S)-3-cyclopentyl-3-hydroxyprop-1-enyl]-5-hydroxy-1,3a,4,5,6,6a-hexahydropentalen-2-yl]methyl]benzoic acid |
| SMILES | O=C(O)c1ccccc1CC1=C[C@H]2C[C@@H](O)[C@@H](C=C[C@@H](O)C3CCCC3)[C@H]2C1 |
| InChI | InChI=1S/C24H30O4/c25-22(16-5-1-2-6-16)10-9-20-21-13-15(12-18(21)14-23(20)26)11-17-7-3-4-8-19(17)24(27)28/h3-4,7-10,12,16,18,20-23,25-26H,1-2,5-6,11,13-14H2,(H,27,28)/t18-,20-,21-,22+,23+/m0/s1 |
| InChIKey | LNDMHDQOZVFQQH-YRFMLNNJSA-N |
| XLogP | 3.98 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|