C28H38O4 — CID 57089135
2-[5-[(3aS,5R,6S,6aS)-6-[(3S)-3-cyclopentyl-3-hydroxyprop-1-enyl]-5-hydroxy-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pentyl]benzoic acid (PubChem CID 57089135) has the molecular formula C28H38O4 and a molecular weight of 438.61 g/mol. Its IUPAC name is 2-[5-[(3aS,5R,6S,6aS)-6-[(3S)-3-cyclopentyl-3-hydroxyprop-1-enyl]-5-hydroxy-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pentyl]benzoic acid.
| Compound Name | 2-[5-[(3aS,5R,6S,6aS)-6-[(3S)-3-cyclopentyl-3-hydroxyprop-1-enyl]-5-hydroxy-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pentyl]benzoic acid |
|---|---|
| PubChem CID | 57089135 |
| Molecular Formula | C28H38O4 |
| Molecular Weight | 438.61 g/mol |
| Exact Mass | 438.28 |
| IUPAC Name | 2-[5-[(3aS,5R,6S,6aS)-6-[(3S)-3-cyclopentyl-3-hydroxyprop-1-enyl]-5-hydroxy-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pentyl]benzoic acid |
| SMILES | O=C(O)c1ccccc1CCCCCC1=C[C@H]2C[C@@H](O)[C@@H](C=C[C@@H](O)C3CCCC3)[C@H]2C1 |
| InChI | InChI=1S/C28H38O4/c29-26(21-11-4-5-12-21)15-14-24-25-17-19(16-22(25)18-27(24)30)8-2-1-3-9-20-10-6-7-13-23(20)28(31)32/h6-7,10,13-16,21-22,24-27,29-30H,1-5,8-9,11-12,17-18H2,(H,31,32)/t22-,24-,25-,26+,27+/m0/s1 |
| InChIKey | BOLPNSMFEFNXIN-JFZJWBCSSA-N |
| XLogP | 5.54 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.61 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|