C26H36O4 — CID 57169798
2-[2-[(3aS,5R,6S,6aS)-5-hydroxy-6-[(3S)-3-hydroxy-5-methyloct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]ethyl]benzoic acid (PubChem CID 57169798) has the molecular formula C26H36O4 and a molecular weight of 412.57 g/mol. Its IUPAC name is 2-[2-[(3aS,5R,6S,6aS)-5-hydroxy-6-[(3S)-3-hydroxy-5-methyloct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]ethyl]benzoic acid.
| Compound Name | 2-[2-[(3aS,5R,6S,6aS)-5-hydroxy-6-[(3S)-3-hydroxy-5-methyloct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]ethyl]benzoic acid |
|---|---|
| PubChem CID | 57169798 |
| Molecular Formula | C26H36O4 |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.26 |
| IUPAC Name | 2-[2-[(3aS,5R,6S,6aS)-5-hydroxy-6-[(3S)-3-hydroxy-5-methyloct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]ethyl]benzoic acid |
| SMILES | CCCC(C)C[C@H](O)C=C[C@H]1[C@H]2CC(CCc3ccccc3C(=O)O)=C[C@H]2C[C@H]1O |
| InChI | InChI=1S/C26H36O4/c1-3-6-17(2)13-21(27)11-12-23-24-15-18(14-20(24)16-25(23)28)9-10-19-7-4-5-8-22(19)26(29)30/h4-5,7-8,11-12,14,17,20-21,23-25,27-28H,3,6,9-10,13,15-16H2,1-2H3,(H,29,30)/t17?,20-,21+,23-,24-,25+/m0/s1 |
| InChIKey | NTZGIJSNOWUJEE-QGIMVZGJSA-N |
| XLogP | 5.00 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|