C25H43NO2 — CID 90830588
(2R,3R,3aS,6aS)-5-[5-(dimethylamino)pent-1-enyl]-3-[(3S,5S)-3-hydroxy-5-methylnon-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol (PubChem CID 90830588) has the molecular formula C25H43NO2 and a molecular weight of 389.62 g/mol. Its IUPAC name is (2R,3R,3aS,6aS)-5-[5-(dimethylamino)pent-1-enyl]-3-[(3S,5S)-3-hydroxy-5-methylnon-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol.
| Compound Name | (2R,3R,3aS,6aS)-5-[5-(dimethylamino)pent-1-enyl]-3-[(3S,5S)-3-hydroxy-5-methylnon-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol |
|---|---|
| PubChem CID | 90830588 |
| Molecular Formula | C25H43NO2 |
| Molecular Weight | 389.62 g/mol |
| Exact Mass | 389.33 |
| IUPAC Name | (2R,3R,3aS,6aS)-5-[5-(dimethylamino)pent-1-enyl]-3-[(3S,5S)-3-hydroxy-5-methylnon-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol |
| SMILES | CCCC[C@H](C)C[C@H](O)C=C[C@@H]1[C@H]2CC(C=CCCCN(C)C)=C[C@H]2C[C@H]1O |
| InChI | InChI=1S/C25H43NO2/c1-5-6-10-19(2)15-22(27)12-13-23-24-17-20(16-21(24)18-25(23)28)11-8-7-9-14-26(3)4/h8,11-13,16,19,21-25,27-28H,5-7,9-10,14-15,17-18H2,1-4H3/t19-,21-,22+,23+,24-,25+/m0/s1 |
| InChIKey | XSDCMLXKHSHTAF-IESFANJTSA-N |
| XLogP | 4.96 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.62 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|