C6H7Cl3 — CID 102247627
(2Z,4E)-1,3,6-trichlorohexa-2,4-diene (PubChem CID 102247627) has the molecular formula C6H7Cl3 and a molecular weight of 185.48 g/mol. Its IUPAC name is (2Z,4E)-1,3,6-trichlorohexa-2,4-diene.
| Compound Name | (2Z,4E)-1,3,6-trichlorohexa-2,4-diene |
|---|---|
| PubChem CID | 102247627 |
| Molecular Formula | C6H7Cl3 |
| Molecular Weight | 185.48 g/mol |
| Exact Mass | 183.96 |
| IUPAC Name | (2Z,4E)-1,3,6-trichlorohexa-2,4-diene |
| SMILES | ClC/C=C(Cl)/C=C/CCl |
| InChI | InChI=1S/C6H7Cl3/c7-4-1-2-6(9)3-5-8/h1-3H,4-5H2/b2-1+,6-3- |
| InChIKey | PYDVYDNLXBPAKV-AOVUDYDWSA-N |
| XLogP | 3.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.48 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|