C4H5BrCl2 — CID 10910617
(Z)-2-bromo-1,4-dichlorobut-2-ene (PubChem CID 10910617) has the molecular formula C4H5BrCl2 and a molecular weight of 203.89 g/mol. Its IUPAC name is (Z)-2-bromo-1,4-dichlorobut-2-ene.
| Compound Name | (Z)-2-bromo-1,4-dichlorobut-2-ene |
|---|---|
| PubChem CID | 10910617 |
| Molecular Formula | C4H5BrCl2 |
| Molecular Weight | 203.89 g/mol |
| Exact Mass | 201.90 |
| IUPAC Name | (Z)-2-bromo-1,4-dichlorobut-2-ene |
| SMILES | ClC/C=C(\Br)CCl |
| InChI | InChI=1S/C4H5BrCl2/c5-4(3-7)1-2-6/h1H,2-3H2/b4-1- |
| InChIKey | HWSPMTUHKZBASS-RJRFIUFISA-N |
| XLogP | 2.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.89 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|