C6H10Cl2O — CID 138546725
(E)-1,3-dichloro-4-methoxypent-2-ene (PubChem CID 138546725) has the molecular formula C6H10Cl2O and a molecular weight of 169.05 g/mol. Its IUPAC name is (E)-1,3-dichloro-4-methoxypent-2-ene.
| Compound Name | (E)-1,3-dichloro-4-methoxypent-2-ene |
|---|---|
| PubChem CID | 138546725 |
| Molecular Formula | C6H10Cl2O |
| Molecular Weight | 169.05 g/mol |
| Exact Mass | 168.01 |
| IUPAC Name | (E)-1,3-dichloro-4-methoxypent-2-ene |
| SMILES | COC(C)/C(Cl)=C\CCl |
| InChI | InChI=1S/C6H10Cl2O/c1-5(9-2)6(8)3-4-7/h3,5H,4H2,1-2H3/b6-3+ |
| InChIKey | UJBAEMOEMYNQSM-ZZXKWVIFSA-N |
| XLogP | 2.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.05 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|