C10H17ClO — CID 102247674
(3Z)-3-chloro-2-methoxy-7-methylocta-1,3-diene (PubChem CID 102247674) has the molecular formula C10H17ClO and a molecular weight of 188.70 g/mol. Its IUPAC name is (3Z)-3-chloro-2-methoxy-7-methylocta-1,3-diene.
| Compound Name | (3Z)-3-chloro-2-methoxy-7-methylocta-1,3-diene |
|---|---|
| PubChem CID | 102247674 |
| Molecular Formula | C10H17ClO |
| Molecular Weight | 188.70 g/mol |
| Exact Mass | 188.10 |
| IUPAC Name | (3Z)-3-chloro-2-methoxy-7-methylocta-1,3-diene |
| SMILES | C=C(OC)/C(Cl)=C/CCC(C)C |
| InChI | InChI=1S/C10H17ClO/c1-8(2)6-5-7-10(11)9(3)12-4/h7-8H,3,5-6H2,1-2,4H3/b10-7- |
| InChIKey | PONVNQCVUVJKBV-YFHOEESVSA-N |
| XLogP | 3.71 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.70 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|