C7H11ClO2 — CID 167199503
(3E)-4-chloro-5-methoxyhexa-3,5-dien-2-ol (PubChem CID 167199503) has the molecular formula C7H11ClO2 and a molecular weight of 162.62 g/mol. Its IUPAC name is (3E)-4-chloro-5-methoxyhexa-3,5-dien-2-ol.
| Compound Name | (3E)-4-chloro-5-methoxyhexa-3,5-dien-2-ol |
|---|---|
| PubChem CID | 167199503 |
| Molecular Formula | C7H11ClO2 |
| Molecular Weight | 162.62 g/mol |
| Exact Mass | 162.04 |
| IUPAC Name | (3E)-4-chloro-5-methoxyhexa-3,5-dien-2-ol |
| SMILES | C=C(OC)/C(Cl)=C\C(C)O |
| InChI | InChI=1S/C7H11ClO2/c1-5(9)4-7(8)6(2)10-3/h4-5,9H,2H2,1,3H3/b7-4+ |
| InChIKey | IROFTLLZVYFEQW-QPJJXVBHSA-N |
| XLogP | 1.65 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.62 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|