(2E,4E)-1,5,6-trimethoxyhepta-2,4,6-triene-3-sulfonyl chloride

C10H15ClO5S — CID 121314959

IUPAC(2E,4E)-1,5,6-trimethoxyhepta-2,4,6-triene-3-sulfonyl chloride
SMILESC=C(OC)/C(=C\C(=C/COC)S(=O)(=O)Cl)OC
InChIInChI=1S/C10H15ClO5S/c1-8(15-3)10(16-4)7-9(5-6-14-2)17(11,12)13/h5,7H,1,6H2,2-4H3/b9-5+,10-7+
InChIKeyXIWQFQFXXPWHGV-FWMCCXIMSA-N
MW282.75 g/mol
LogP1.78
Rot. Bonds7

About (2E,4E)-1,5,6-trimethoxyhepta-2,4,6-triene-3-sulfonyl chloride

(2E,4E)-1,5,6-trimethoxyhepta-2,4,6-triene-3-sulfonyl chloride (PubChem CID 121314959) has the molecular formula C10H15ClO5S and a molecular weight of 282.75 g/mol. Its IUPAC name is (2E,4E)-1,5,6-trimethoxyhepta-2,4,6-triene-3-sulfonyl chloride.

Molecular Properties

Compound Name(2E,4E)-1,5,6-trimethoxyhepta-2,4,6-triene-3-sulfonyl chloride
PubChem CID121314959
Molecular FormulaC10H15ClO5S
Molecular Weight282.75 g/mol
Exact Mass282.03
IUPAC Name(2E,4E)-1,5,6-trimethoxyhepta-2,4,6-triene-3-sulfonyl chloride
SMILESC=C(OC)/C(=C\C(=C/COC)S(=O)(=O)Cl)OC
InChIInChI=1S/C10H15ClO5S/c1-8(15-3)10(16-4)7-9(5-6-14-2)17(11,12)13/h5,7H,1,6H2,2-4H3/b9-5+,10-7+
InChIKeyXIWQFQFXXPWHGV-FWMCCXIMSA-N
XLogP1.78
TPSA61.83 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds7
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500282.75
LogP ≤ 51.78
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze (2E,4E)-1,5,6-trimethoxyhepta-2,4,6-triene-3-sulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2E,4E)-1,5,6-trimethoxyhepta-2,4,6-triene-3-sulfonyl chloride?
The IUPAC name of (2E,4E)-1,5,6-trimethoxyhepta-2,4,6-triene-3-sulfonyl chloride (CID 121314959) is (2E,4E)-1,5,6-trimethoxyhepta-2,4,6-triene-3-sulfonyl chloride.
What is the SMILES notation for (2E,4E)-1,5,6-trimethoxyhepta-2,4,6-triene-3-sulfonyl chloride?
The canonical SMILES for (2E,4E)-1,5,6-trimethoxyhepta-2,4,6-triene-3-sulfonyl chloride is C=C(OC)/C(=C\C(=C/COC)S(=O)(=O)Cl)OC.
What is the InChIKey of (2E,4E)-1,5,6-trimethoxyhepta-2,4,6-triene-3-sulfonyl chloride?
The InChIKey is XIWQFQFXXPWHGV-FWMCCXIMSA-N. The full InChI is InChI=1S/C10H15ClO5S/c1-8(15-3)10(16-4)7-9(5-6-14-2)17(11,12)13/h5,7H,1,6H2,2-4H3/b9-5+,10-7+.
What are the key properties of (2E,4E)-1,5,6-trimethoxyhepta-2,4,6-triene-3-sulfonyl chloride?
(2E,4E)-1,5,6-trimethoxyhepta-2,4,6-triene-3-sulfonyl chloride has a molecular weight of 282.75 g/mol, XLogP of 1.78, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,4E)-1,5,6-trimethoxyhepta-2,4,6-triene-3-sulfonyl chloride is sourced from PubChem (CID 121314959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).