C10H15ClO5S — CID 121314959
(2E,4E)-1,5,6-trimethoxyhepta-2,4,6-triene-3-sulfonyl chloride (PubChem CID 121314959) has the molecular formula C10H15ClO5S and a molecular weight of 282.75 g/mol. Its IUPAC name is (2E,4E)-1,5,6-trimethoxyhepta-2,4,6-triene-3-sulfonyl chloride.
| Compound Name | (2E,4E)-1,5,6-trimethoxyhepta-2,4,6-triene-3-sulfonyl chloride |
|---|---|
| PubChem CID | 121314959 |
| Molecular Formula | C10H15ClO5S |
| Molecular Weight | 282.75 g/mol |
| Exact Mass | 282.03 |
| IUPAC Name | (2E,4E)-1,5,6-trimethoxyhepta-2,4,6-triene-3-sulfonyl chloride |
| SMILES | C=C(OC)/C(=C\C(=C/COC)S(=O)(=O)Cl)OC |
| InChI | InChI=1S/C10H15ClO5S/c1-8(15-3)10(16-4)7-9(5-6-14-2)17(11,12)13/h5,7H,1,6H2,2-4H3/b9-5+,10-7+ |
| InChIKey | XIWQFQFXXPWHGV-FWMCCXIMSA-N |
| XLogP | 1.78 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.75 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|