C9H15NO2 — CID 143808617
N-[(2E,4E)-4-(hydroxymethyl)hexa-2,4-dien-3-yl]acetamide (PubChem CID 143808617) has the molecular formula C9H15NO2 and a molecular weight of 169.22 g/mol. Its IUPAC name is N-[(2E,4E)-4-(hydroxymethyl)hexa-2,4-dien-3-yl]acetamide.
| Compound Name | N-[(2E,4E)-4-(hydroxymethyl)hexa-2,4-dien-3-yl]acetamide |
|---|---|
| PubChem CID | 143808617 |
| Molecular Formula | C9H15NO2 |
| Molecular Weight | 169.22 g/mol |
| Exact Mass | 169.11 |
| IUPAC Name | N-[(2E,4E)-4-(hydroxymethyl)hexa-2,4-dien-3-yl]acetamide |
| SMILES | C/C=C(CO)\C(=C/C)NC(C)=O |
| InChI | InChI=1S/C9H15NO2/c1-4-8(6-11)9(5-2)10-7(3)12/h4-5,11H,6H2,1-3H3,(H,10,12)/b8-4-,9-5+ |
| InChIKey | JAYKDNYTYSQRKE-MVTUOISNSA-N |
| XLogP | 0.96 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.22 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|