About (Z)-2-acetamido-N,4-dimethylpent-2-enamide
(Z)-2-acetamido-N,4-dimethylpent-2-enamide (PubChem CID 102329590) has the molecular formula C9H16N2O2
and a molecular weight of 184.24 g/mol. Its IUPAC name is (Z)-2-acetamido-N,4-dimethylpent-2-enamide.
Molecular Properties
| Compound Name | (Z)-2-acetamido-N,4-dimethylpent-2-enamide |
| PubChem CID | 102329590 |
| Molecular Formula | C9H16N2O2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.12 |
| IUPAC Name | (Z)-2-acetamido-N,4-dimethylpent-2-enamide |
| SMILES | CNC(=O)/C(=C/C(C)C)NC(C)=O |
| InChI | InChI=1S/C9H16N2O2/c1-6(2)5-8(9(13)10-4)11-7(3)12/h5-6H,1-4H3,(H,10,13)(H,11,12)/b8-5- |
| InChIKey | BQKPVNFXIAVIFH-YVMONPNESA-N |
| XLogP | 0.41 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2-acetamido-N,4-dimethylpent-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-acetamido-N,4-dimethylpent-2-enamide?
The IUPAC name of (Z)-2-acetamido-N,4-dimethylpent-2-enamide (CID 102329590) is (Z)-2-acetamido-N,4-dimethylpent-2-enamide.
What is the SMILES notation for (Z)-2-acetamido-N,4-dimethylpent-2-enamide?
The canonical SMILES for (Z)-2-acetamido-N,4-dimethylpent-2-enamide is CNC(=O)/C(=C/C(C)C)NC(C)=O.
What is the InChIKey of (Z)-2-acetamido-N,4-dimethylpent-2-enamide?
The InChIKey is BQKPVNFXIAVIFH-YVMONPNESA-N. The full InChI is InChI=1S/C9H16N2O2/c1-6(2)5-8(9(13)10-4)11-7(3)12/h5-6H,1-4H3,(H,10,13)(H,11,12)/b8-5-.
What are the key properties of (Z)-2-acetamido-N,4-dimethylpent-2-enamide?
(Z)-2-acetamido-N,4-dimethylpent-2-enamide has a molecular weight of 184.24 g/mol, XLogP of 0.41, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-acetamido-N,4-dimethylpent-2-enamide is sourced from PubChem (CID 102329590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).