C10H16N2O4 — CID 131859719
2-[(2-acetamidoacetyl)amino]-4-methylpent-2-enoic acid (PubChem CID 131859719) has the molecular formula C10H16N2O4 and a molecular weight of 228.25 g/mol. Its IUPAC name is 2-[(2-acetamidoacetyl)amino]-4-methylpent-2-enoic acid.
| Compound Name | 2-[(2-acetamidoacetyl)amino]-4-methylpent-2-enoic acid |
|---|---|
| PubChem CID | 131859719 |
| Molecular Formula | C10H16N2O4 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | 2-[(2-acetamidoacetyl)amino]-4-methylpent-2-enoic acid |
| SMILES | CC(=O)NCC(=O)NC(=CC(C)C)C(=O)O |
| InChI | InChI=1S/C10H16N2O4/c1-6(2)4-8(10(15)16)12-9(14)5-11-7(3)13/h4,6H,5H2,1-3H3,(H,11,13)(H,12,14)(H,15,16) |
| InChIKey | WKWSHZORKXNICF-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|