C25H39N3O5S — CID 85326789
2-[[2-[(2-acetamidoacetyl)amino]acetyl]amino]-3-(3,7,10,11-tetramethyldodeca-2,6,10-trienylsulfanyl)prop-2-enoic acid (PubChem CID 85326789) has the molecular formula C25H39N3O5S and a molecular weight of 493.67 g/mol. Its IUPAC name is 2-[[2-[(2-acetamidoacetyl)amino]acetyl]amino]-3-(3,7,10,11-tetramethyldodeca-2,6,10-trienylsulfanyl)prop-2-enoic acid.
| Compound Name | 2-[[2-[(2-acetamidoacetyl)amino]acetyl]amino]-3-(3,7,10,11-tetramethyldodeca-2,6,10-trienylsulfanyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 85326789 |
| Molecular Formula | C25H39N3O5S |
| Molecular Weight | 493.67 g/mol |
| Exact Mass | 493.26 |
| IUPAC Name | 2-[[2-[(2-acetamidoacetyl)amino]acetyl]amino]-3-(3,7,10,11-tetramethyldodeca-2,6,10-trienylsulfanyl)prop-2-enoic acid |
| SMILES | CC(=O)NCC(=O)NCC(=O)NC(=CSCC=C(C)CCC=C(C)CCC(C)=C(C)C)C(=O)O |
| InChI | InChI=1S/C25H39N3O5S/c1-17(2)20(5)11-10-18(3)8-7-9-19(4)12-13-34-16-22(25(32)33)28-24(31)15-27-23(30)14-26-21(6)29/h8,12,16H,7,9-11,13-15H2,1-6H3,(H,26,29)(H,27,30)(H,28,31)(H,32,33) |
| InChIKey | RFYQJPOSIXYJKV-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.67 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|