C11H18N4O7 — CID 175851403
2-[[[2-[[2-[(2-acetamidoacetyl)amino]acetyl]amino]acetyl]amino]methoxy]acetic acid (PubChem CID 175851403) has the molecular formula C11H18N4O7 and a molecular weight of 318.29 g/mol. Its IUPAC name is 2-[[[2-[[2-[(2-acetamidoacetyl)amino]acetyl]amino]acetyl]amino]methoxy]acetic acid.
| Compound Name | 2-[[[2-[[2-[(2-acetamidoacetyl)amino]acetyl]amino]acetyl]amino]methoxy]acetic acid |
|---|---|
| PubChem CID | 175851403 |
| Molecular Formula | C11H18N4O7 |
| Molecular Weight | 318.29 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 2-[[[2-[[2-[(2-acetamidoacetyl)amino]acetyl]amino]acetyl]amino]methoxy]acetic acid |
| SMILES | CC(=O)NCC(=O)NCC(=O)NCC(=O)NCOCC(=O)O |
| InChI | InChI=1S/C11H18N4O7/c1-7(16)12-2-8(17)13-3-9(18)14-4-10(19)15-6-22-5-11(20)21/h2-6H2,1H3,(H,12,16)(H,13,17)(H,14,18)(H,15,19)(H,20,21) |
| InChIKey | XATOOCYCGTUFSA-UHFFFAOYSA-N |
| XLogP | -3.47 |
| TPSA | 162.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.29 |
| LogP ≤ 5 | -3.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|