C7H12N2O4 — CID 126495792
[(2-acetamidoacetyl)amino]methyl acetate (PubChem CID 126495792) has the molecular formula C7H12N2O4 and a molecular weight of 188.18 g/mol. Its IUPAC name is [(2-acetamidoacetyl)amino]methyl acetate.
| Compound Name | [(2-acetamidoacetyl)amino]methyl acetate |
|---|---|
| PubChem CID | 126495792 |
| Molecular Formula | C7H12N2O4 |
| Molecular Weight | 188.18 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | [(2-acetamidoacetyl)amino]methyl acetate |
| SMILES | CC(=O)NCC(=O)NCOC(C)=O |
| InChI | InChI=1S/C7H12N2O4/c1-5(10)8-3-7(12)9-4-13-6(2)11/h3-4H2,1-2H3,(H,8,10)(H,9,12) |
| InChIKey | UESUGNRRCRSHFJ-UHFFFAOYSA-N |
| XLogP | -1.24 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.18 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|