C10H16N2O5 — CID 102351837
methyl 5-[(2-acetamidoacetyl)amino]-3-oxopentanoate (PubChem CID 102351837) has the molecular formula C10H16N2O5 and a molecular weight of 244.25 g/mol. Its IUPAC name is methyl 5-[(2-acetamidoacetyl)amino]-3-oxopentanoate.
| Compound Name | methyl 5-[(2-acetamidoacetyl)amino]-3-oxopentanoate |
|---|---|
| PubChem CID | 102351837 |
| Molecular Formula | C10H16N2O5 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | methyl 5-[(2-acetamidoacetyl)amino]-3-oxopentanoate |
| SMILES | COC(=O)CC(=O)CCNC(=O)CNC(C)=O |
| InChI | InChI=1S/C10H16N2O5/c1-7(13)12-6-9(15)11-4-3-8(14)5-10(16)17-2/h3-6H2,1-2H3,(H,11,15)(H,12,13) |
| InChIKey | WXGAGAPBLYYGKF-UHFFFAOYSA-N |
| XLogP | -1.24 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|