C13H22N2O5 — CID 102351841
methyl 5-[[(2S)-2-acetamido-3-methylbutanoyl]amino]-3-oxopentanoate (PubChem CID 102351841) has the molecular formula C13H22N2O5 and a molecular weight of 286.33 g/mol. Its IUPAC name is methyl 5-[[(2S)-2-acetamido-3-methylbutanoyl]amino]-3-oxopentanoate.
| Compound Name | methyl 5-[[(2S)-2-acetamido-3-methylbutanoyl]amino]-3-oxopentanoate |
|---|---|
| PubChem CID | 102351841 |
| Molecular Formula | C13H22N2O5 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | methyl 5-[[(2S)-2-acetamido-3-methylbutanoyl]amino]-3-oxopentanoate |
| SMILES | COC(=O)CC(=O)CCNC(=O)[C@@H](NC(C)=O)C(C)C |
| InChI | InChI=1S/C13H22N2O5/c1-8(2)12(15-9(3)16)13(19)14-6-5-10(17)7-11(18)20-4/h8,12H,5-7H2,1-4H3,(H,14,19)(H,15,16)/t12-/m0/s1 |
| InChIKey | QYQWMFXMDZZGLL-LBPRGKRZSA-N |
| XLogP | -0.21 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|