About fermium;[[2-(oxomethylamino)acetyl]amino]methyl acetate
fermium;[[2-(oxomethylamino)acetyl]amino]methyl acetate (PubChem CID 168986451) has the molecular formula C6H9FmN2O4-
and a molecular weight of 430.15 g/mol. Its IUPAC name is fermium;[[2-(oxomethylamino)acetyl]amino]methyl acetate.
Molecular Properties
| Compound Name | fermium;[[2-(oxomethylamino)acetyl]amino]methyl acetate |
| PubChem CID | 168986451 |
| Molecular Formula | C6H9FmN2O4- |
| Molecular Weight | 430.15 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | fermium;[[2-(oxomethylamino)acetyl]amino]methyl acetate |
| SMILES | CC(=O)OCNC(=O)CN[C-]=O.[Fm] |
| InChI | InChI=1S/C6H9N2O4.Fm/c1-5(10)12-4-8-6(11)2-7-3-9;/h2,4H2,1H3,(H,7,9)(H,8,11);/q-1; |
| InChIKey | RTNDWENARMNWCK-UHFFFAOYSA-N |
| XLogP | -1.72 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 430.15 |
| LogP ≤ 5 | -1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze fermium;[[2-(oxomethylamino)acetyl]amino]methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fermium;[[2-(oxomethylamino)acetyl]amino]methyl acetate?
The IUPAC name of fermium;[[2-(oxomethylamino)acetyl]amino]methyl acetate (CID 168986451) is fermium;[[2-(oxomethylamino)acetyl]amino]methyl acetate.
What is the SMILES notation for fermium;[[2-(oxomethylamino)acetyl]amino]methyl acetate?
The canonical SMILES for fermium;[[2-(oxomethylamino)acetyl]amino]methyl acetate is CC(=O)OCNC(=O)CN[C-]=O.[Fm].
What is the InChIKey of fermium;[[2-(oxomethylamino)acetyl]amino]methyl acetate?
The InChIKey is RTNDWENARMNWCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N2O4.Fm/c1-5(10)12-4-8-6(11)2-7-3-9;/h2,4H2,1H3,(H,7,9)(H,8,11);/q-1;.
What are the key properties of fermium;[[2-(oxomethylamino)acetyl]amino]methyl acetate?
fermium;[[2-(oxomethylamino)acetyl]amino]methyl acetate has a molecular weight of 430.15 g/mol, XLogP of -1.72, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for fermium;[[2-(oxomethylamino)acetyl]amino]methyl acetate is sourced from PubChem (CID 168986451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).