About (hexanoylamino)methyl acetate
(hexanoylamino)methyl acetate (PubChem CID 20979306) has the molecular formula C9H17NO3
and a molecular weight of 187.24 g/mol. Its IUPAC name is (hexanoylamino)methyl acetate.
Molecular Properties
| Compound Name | (hexanoylamino)methyl acetate |
| PubChem CID | 20979306 |
| Molecular Formula | C9H17NO3 |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.12 |
| IUPAC Name | (hexanoylamino)methyl acetate |
| SMILES | CCCCCC(=O)NCOC(C)=O |
| InChI | InChI=1S/C9H17NO3/c1-3-4-5-6-9(12)10-7-13-8(2)11/h3-7H2,1-2H3,(H,10,12) |
| InChIKey | ABPVOHVDLFZIRT-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (hexanoylamino)methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (hexanoylamino)methyl acetate?
The IUPAC name of (hexanoylamino)methyl acetate (CID 20979306) is (hexanoylamino)methyl acetate.
What is the SMILES notation for (hexanoylamino)methyl acetate?
The canonical SMILES for (hexanoylamino)methyl acetate is CCCCCC(=O)NCOC(C)=O.
What is the InChIKey of (hexanoylamino)methyl acetate?
The InChIKey is ABPVOHVDLFZIRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO3/c1-3-4-5-6-9(12)10-7-13-8(2)11/h3-7H2,1-2H3,(H,10,12).
What are the key properties of (hexanoylamino)methyl acetate?
(hexanoylamino)methyl acetate has a molecular weight of 187.24 g/mol, XLogP of 1.20, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (hexanoylamino)methyl acetate is sourced from PubChem (CID 20979306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).