C20H31NO3S — CID 20821557
(Z)-2-acetamido-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylprop-2-enoic acid (PubChem CID 20821557) has the molecular formula C20H31NO3S and a molecular weight of 365.54 g/mol. Its IUPAC name is (Z)-2-acetamido-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylprop-2-enoic acid.
| Compound Name | (Z)-2-acetamido-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylprop-2-enoic acid |
|---|---|
| PubChem CID | 20821557 |
| Molecular Formula | C20H31NO3S |
| Molecular Weight | 365.54 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | (Z)-2-acetamido-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylprop-2-enoic acid |
| SMILES | CC(=O)N/C(=C\SC/C=C(\C)CC/C=C(\C)CCC=C(C)C)C(=O)O |
| InChI | InChI=1S/C20H31NO3S/c1-15(2)8-6-9-16(3)10-7-11-17(4)12-13-25-14-19(20(23)24)21-18(5)22/h8,10,12,14H,6-7,9,11,13H2,1-5H3,(H,21,22)(H,23,24)/b16-10+,17-12+,19-14- |
| InChIKey | FOYLGUSPVUJOBP-JHTVKFCCSA-N |
| XLogP | 5.20 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.54 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|