C10H19NO — CID 174511197
N,4-dimethyl-2-propan-2-ylpent-2-enamide (PubChem CID 174511197) has the molecular formula C10H19NO and a molecular weight of 169.27 g/mol. Its IUPAC name is N,4-dimethyl-2-propan-2-ylpent-2-enamide.
| Compound Name | N,4-dimethyl-2-propan-2-ylpent-2-enamide |
|---|---|
| PubChem CID | 174511197 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | N,4-dimethyl-2-propan-2-ylpent-2-enamide |
| SMILES | CNC(=O)C(=CC(C)C)C(C)C |
| InChI | InChI=1S/C10H19NO/c1-7(2)6-9(8(3)4)10(12)11-5/h6-8H,1-5H3,(H,11,12) |
| InChIKey | VAMWOMREFNMBEI-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|