C8H15NO2 — CID 141458418
3-hydroxy-N,2,4-trimethylpent-2-enamide (PubChem CID 141458418) has the molecular formula C8H15NO2 and a molecular weight of 157.21 g/mol. Its IUPAC name is 3-hydroxy-N,2,4-trimethylpent-2-enamide.
| Compound Name | 3-hydroxy-N,2,4-trimethylpent-2-enamide |
|---|---|
| PubChem CID | 141458418 |
| Molecular Formula | C8H15NO2 |
| Molecular Weight | 157.21 g/mol |
| Exact Mass | 157.11 |
| IUPAC Name | 3-hydroxy-N,2,4-trimethylpent-2-enamide |
| SMILES | CNC(=O)C(C)=C(O)C(C)C |
| InChI | InChI=1S/C8H15NO2/c1-5(2)7(10)6(3)8(11)9-4/h5,10H,1-4H3,(H,9,11) |
| InChIKey | YRRQNDZYHXIHHZ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.21 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|