About 3-hydroxy-N,2,4-trimethylpent-2-enamide
3-hydroxy-N,2,4-trimethylpent-2-enamide (PubChem CID 141458418) has the molecular formula C8H15NO2
and a molecular weight of 157.21 g/mol. Its IUPAC name is 3-hydroxy-N,2,4-trimethylpent-2-enamide.
Molecular Properties
| Compound Name | 3-hydroxy-N,2,4-trimethylpent-2-enamide |
| PubChem CID | 141458418 |
| Molecular Formula | C8H15NO2 |
| Molecular Weight | 157.21 g/mol |
| Exact Mass | 157.11 |
| IUPAC Name | 3-hydroxy-N,2,4-trimethylpent-2-enamide |
| SMILES | CNC(=O)C(C)=C(O)C(C)C |
| InChI | InChI=1S/C8H15NO2/c1-5(2)7(10)6(3)8(11)9-4/h5,10H,1-4H3,(H,9,11) |
| InChIKey | YRRQNDZYHXIHHZ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.21 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxy-N,2,4-trimethylpent-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-N,2,4-trimethylpent-2-enamide?
The IUPAC name of 3-hydroxy-N,2,4-trimethylpent-2-enamide (CID 141458418) is 3-hydroxy-N,2,4-trimethylpent-2-enamide.
What is the SMILES notation for 3-hydroxy-N,2,4-trimethylpent-2-enamide?
The canonical SMILES for 3-hydroxy-N,2,4-trimethylpent-2-enamide is CNC(=O)C(C)=C(O)C(C)C.
What is the InChIKey of 3-hydroxy-N,2,4-trimethylpent-2-enamide?
The InChIKey is YRRQNDZYHXIHHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO2/c1-5(2)7(10)6(3)8(11)9-4/h5,10H,1-4H3,(H,9,11).
What are the key properties of 3-hydroxy-N,2,4-trimethylpent-2-enamide?
3-hydroxy-N,2,4-trimethylpent-2-enamide has a molecular weight of 157.21 g/mol, XLogP of 1.22, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-N,2,4-trimethylpent-2-enamide is sourced from PubChem (CID 141458418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).