C11H22N2O — CID 59973721
(E,4R)-N,2,3,5-tetramethyl-4-(methylamino)hex-2-enamide (PubChem CID 59973721) has the molecular formula C11H22N2O and a molecular weight of 198.31 g/mol. Its IUPAC name is (E,4R)-N,2,3,5-tetramethyl-4-(methylamino)hex-2-enamide.
| Compound Name | (E,4R)-N,2,3,5-tetramethyl-4-(methylamino)hex-2-enamide |
|---|---|
| PubChem CID | 59973721 |
| Molecular Formula | C11H22N2O |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.17 |
| IUPAC Name | (E,4R)-N,2,3,5-tetramethyl-4-(methylamino)hex-2-enamide |
| SMILES | CNC(=O)/C(C)=C(\C)[C@H](NC)C(C)C |
| InChI | InChI=1S/C11H22N2O/c1-7(2)10(12-5)8(3)9(4)11(14)13-6/h7,10,12H,1-6H3,(H,13,14)/b9-8+/t10-/m1/s1 |
| InChIKey | TYTIJLLAULUCFV-AAXQSMANSA-N |
| XLogP | 1.31 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|