C9H13NO2 — CID 141236596
N,2,3-trimethyl-4-oxohexa-2,5-dienamide (PubChem CID 141236596) has the molecular formula C9H13NO2 and a molecular weight of 167.21 g/mol. Its IUPAC name is N,2,3-trimethyl-4-oxohexa-2,5-dienamide.
| Compound Name | N,2,3-trimethyl-4-oxohexa-2,5-dienamide |
|---|---|
| PubChem CID | 141236596 |
| Molecular Formula | C9H13NO2 |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | N,2,3-trimethyl-4-oxohexa-2,5-dienamide |
| SMILES | C=CC(=O)C(C)=C(C)C(=O)NC |
| InChI | InChI=1S/C9H13NO2/c1-5-8(11)6(2)7(3)9(12)10-4/h5H,1H2,2-4H3,(H,10,12) |
| InChIKey | WGRDIMRPBVFXMX-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|