C11H21NO — CID 143963041
ethane;(E,3Z)-3-ethylidene-4-(methylamino)hex-4-enal (PubChem CID 143963041) has the molecular formula C11H21NO and a molecular weight of 183.29 g/mol. Its IUPAC name is ethane;(E,3Z)-3-ethylidene-4-(methylamino)hex-4-enal.
| Compound Name | ethane;(E,3Z)-3-ethylidene-4-(methylamino)hex-4-enal |
|---|---|
| PubChem CID | 143963041 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | ethane;(E,3Z)-3-ethylidene-4-(methylamino)hex-4-enal |
| SMILES | C/C=C(CC=O)\C(=C/C)NC.CC |
| InChI | InChI=1S/C9H15NO.C2H6/c1-4-8(6-7-11)9(5-2)10-3;1-2/h4-5,7,10H,6H2,1-3H3;1-2H3/b8-4-,9-5+; |
| InChIKey | XPGQZCWQQQPMIG-UZKJHERWSA-N |
| XLogP | 2.67 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|