C7H11Br2N — CID 142852445
(2E,4E)-4,6-dibromo-N-methylhexa-2,4-dien-3-amine (PubChem CID 142852445) has the molecular formula C7H11Br2N and a molecular weight of 268.98 g/mol. Its IUPAC name is (2E,4E)-4,6-dibromo-N-methylhexa-2,4-dien-3-amine.
| Compound Name | (2E,4E)-4,6-dibromo-N-methylhexa-2,4-dien-3-amine |
|---|---|
| PubChem CID | 142852445 |
| Molecular Formula | C7H11Br2N |
| Molecular Weight | 268.98 g/mol |
| Exact Mass | 266.93 |
| IUPAC Name | (2E,4E)-4,6-dibromo-N-methylhexa-2,4-dien-3-amine |
| SMILES | C/C=C(NC)\C(Br)=C/CBr |
| InChI | InChI=1S/C7H11Br2N/c1-3-7(10-2)6(9)4-5-8/h3-4,10H,5H2,1-2H3/b6-4+,7-3+ |
| InChIKey | BUBWQRDNKAEYFQ-DVFLZCIWSA-N |
| XLogP | 2.78 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.98 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|