C6H10Br2 — CID 11064563
(Z)-1,3-dibromo-4-methylpent-2-ene (PubChem CID 11064563) has the molecular formula C6H10Br2 and a molecular weight of 241.95 g/mol. Its IUPAC name is (Z)-1,3-dibromo-4-methylpent-2-ene.
| Compound Name | (Z)-1,3-dibromo-4-methylpent-2-ene |
|---|---|
| PubChem CID | 11064563 |
| Molecular Formula | C6H10Br2 |
| Molecular Weight | 241.95 g/mol |
| Exact Mass | 239.91 |
| IUPAC Name | (Z)-1,3-dibromo-4-methylpent-2-ene |
| SMILES | CC(C)/C(Br)=C/CBr |
| InChI | InChI=1S/C6H10Br2/c1-5(2)6(8)3-4-7/h3,5H,4H2,1-2H3/b6-3- |
| InChIKey | JJISLIPLUDBXJS-UTCJRWHESA-N |
| XLogP | 3.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.95 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|