C10H17N5O2 — CID 118147048
1-amino-3-[(3E,5Z)-2-(carbamoylamino)octa-1,3,5-trien-4-yl]urea (PubChem CID 118147048) has the molecular formula C10H17N5O2 and a molecular weight of 239.28 g/mol. Its IUPAC name is 1-amino-3-[(3E,5Z)-2-(carbamoylamino)octa-1,3,5-trien-4-yl]urea.
| Compound Name | 1-amino-3-[(3E,5Z)-2-(carbamoylamino)octa-1,3,5-trien-4-yl]urea |
|---|---|
| PubChem CID | 118147048 |
| Molecular Formula | C10H17N5O2 |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | 1-amino-3-[(3E,5Z)-2-(carbamoylamino)octa-1,3,5-trien-4-yl]urea |
| SMILES | C=C(/C=C(\C=C/CC)NC(=O)NN)NC(N)=O |
| InChI | InChI=1S/C10H17N5O2/c1-3-4-5-8(14-10(17)15-12)6-7(2)13-9(11)16/h4-6H,2-3,12H2,1H3,(H3,11,13,16)(H2,14,15,17)/b5-4-,8-6+ |
| InChIKey | WTOZHWVRZFYXTI-GSGSLZOQSA-N |
| XLogP | 0.19 |
| TPSA | 122.27 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|