C11H15F3 — CID 145087185
(3E)-2,6-dimethyl-5-methylidene-3-(trifluoromethyl)hepta-1,3-diene (PubChem CID 145087185) has the molecular formula C11H15F3 and a molecular weight of 204.23 g/mol. Its IUPAC name is (3E)-2,6-dimethyl-5-methylidene-3-(trifluoromethyl)hepta-1,3-diene.
| Compound Name | (3E)-2,6-dimethyl-5-methylidene-3-(trifluoromethyl)hepta-1,3-diene |
|---|---|
| PubChem CID | 145087185 |
| Molecular Formula | C11H15F3 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.11 |
| IUPAC Name | (3E)-2,6-dimethyl-5-methylidene-3-(trifluoromethyl)hepta-1,3-diene |
| SMILES | C=C(C)/C(=C\C(=C)C(C)C)C(F)(F)F |
| InChI | InChI=1S/C11H15F3/c1-7(2)9(5)6-10(8(3)4)11(12,13)14/h6-7H,3,5H2,1-2,4H3/b10-6+ |
| InChIKey | ZKXNMAHLUQYVRQ-UXBLZVDNSA-N |
| XLogP | 4.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|