C11H13F3N2O3 — CID 144863650
2-methyl-N-[(3E)-5-nitro-4-(trifluoromethyl)hexa-1,3,5-trien-2-yl]propanamide (PubChem CID 144863650) has the molecular formula C11H13F3N2O3 and a molecular weight of 278.23 g/mol. Its IUPAC name is 2-methyl-N-[(3E)-5-nitro-4-(trifluoromethyl)hexa-1,3,5-trien-2-yl]propanamide.
| Compound Name | 2-methyl-N-[(3E)-5-nitro-4-(trifluoromethyl)hexa-1,3,5-trien-2-yl]propanamide |
|---|---|
| PubChem CID | 144863650 |
| Molecular Formula | C11H13F3N2O3 |
| Molecular Weight | 278.23 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 2-methyl-N-[(3E)-5-nitro-4-(trifluoromethyl)hexa-1,3,5-trien-2-yl]propanamide |
| SMILES | C=C(/C=C(\C(=C)[N+](=O)[O-])C(F)(F)F)NC(=O)C(C)C |
| InChI | InChI=1S/C11H13F3N2O3/c1-6(2)10(17)15-7(3)5-9(11(12,13)14)8(4)16(18)19/h5-6H,3-4H2,1-2H3,(H,15,17)/b9-5+ |
| InChIKey | IPDCLAVSSKCYKY-WEVVVXLNSA-N |
| XLogP | 2.55 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.23 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|