About 2-methyl-N-[(3Z)-2-methylidene-5-(trifluoromethyl)hexa-3,5-dienyl]propanamide
2-methyl-N-[(3Z)-2-methylidene-5-(trifluoromethyl)hexa-3,5-dienyl]propanamide (PubChem CID 153344451) has the molecular formula C12H16F3NO
and a molecular weight of 247.26 g/mol. Its IUPAC name is 2-methyl-N-[(3Z)-2-methylidene-5-(trifluoromethyl)hexa-3,5-dienyl]propanamide.
Molecular Properties
| Compound Name | 2-methyl-N-[(3Z)-2-methylidene-5-(trifluoromethyl)hexa-3,5-dienyl]propanamide |
| PubChem CID | 153344451 |
| Molecular Formula | C12H16F3NO |
| Molecular Weight | 247.26 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | 2-methyl-N-[(3Z)-2-methylidene-5-(trifluoromethyl)hexa-3,5-dienyl]propanamide |
| SMILES | C=C(/C=C\C(=C)C(F)(F)F)CNC(=O)C(C)C |
| InChI | InChI=1S/C12H16F3NO/c1-8(2)11(17)16-7-9(3)5-6-10(4)12(13,14)15/h5-6,8H,3-4,7H2,1-2H3,(H,16,17)/b6-5- |
| InChIKey | QFCGBEKSRCLUKA-WAYWQWQTSA-N |
| XLogP | 2.99 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.26 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-N-[(3Z)-2-methylidene-5-(trifluoromethyl)hexa-3,5-dienyl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-N-[(3Z)-2-methylidene-5-(trifluoromethyl)hexa-3,5-dienyl]propanamide?
The IUPAC name of 2-methyl-N-[(3Z)-2-methylidene-5-(trifluoromethyl)hexa-3,5-dienyl]propanamide (CID 153344451) is 2-methyl-N-[(3Z)-2-methylidene-5-(trifluoromethyl)hexa-3,5-dienyl]propanamide.
What is the SMILES notation for 2-methyl-N-[(3Z)-2-methylidene-5-(trifluoromethyl)hexa-3,5-dienyl]propanamide?
The canonical SMILES for 2-methyl-N-[(3Z)-2-methylidene-5-(trifluoromethyl)hexa-3,5-dienyl]propanamide is C=C(/C=C\C(=C)C(F)(F)F)CNC(=O)C(C)C.
What is the InChIKey of 2-methyl-N-[(3Z)-2-methylidene-5-(trifluoromethyl)hexa-3,5-dienyl]propanamide?
The InChIKey is QFCGBEKSRCLUKA-WAYWQWQTSA-N. The full InChI is InChI=1S/C12H16F3NO/c1-8(2)11(17)16-7-9(3)5-6-10(4)12(13,14)15/h5-6,8H,3-4,7H2,1-2H3,(H,16,17)/b6-5-.
What are the key properties of 2-methyl-N-[(3Z)-2-methylidene-5-(trifluoromethyl)hexa-3,5-dienyl]propanamide?
2-methyl-N-[(3Z)-2-methylidene-5-(trifluoromethyl)hexa-3,5-dienyl]propanamide has a molecular weight of 247.26 g/mol, XLogP of 2.99, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N-[(3Z)-2-methylidene-5-(trifluoromethyl)hexa-3,5-dienyl]propanamide is sourced from PubChem (CID 153344451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).